C31H42N4O — CID 129034777
2-(4-methylphenyl)-5-(4-methylpiperazin-1-yl)-4-(2,4,6-trimethylphenyl)imino-2-azaspiro[5.5]undecan-1-one (PubChem CID 129034777) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-(4-methylpiperazin-1-yl)-4-(2,4,6-trimethylphenyl)imino-2-azaspiro[5.5]undecan-1-one.
| Compound Name | 2-(4-methylphenyl)-5-(4-methylpiperazin-1-yl)-4-(2,4,6-trimethylphenyl)imino-2-azaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 129034777 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | 2-(4-methylphenyl)-5-(4-methylpiperazin-1-yl)-4-(2,4,6-trimethylphenyl)imino-2-azaspiro[5.5]undecan-1-one |
| SMILES | Cc1ccc(N2C/C(=N\c3c(C)cc(C)cc3C)C(N3CCN(C)CC3)C3(CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C31H42N4O/c1-22-9-11-26(12-10-22)35-21-27(32-28-24(3)19-23(2)20-25(28)4)29(34-17-15-33(5)16-18-34)31(30(35)36)13-7-6-8-14-31/h9-12,19-20,29H,6-8,13-18,21H2,1-5H3/b32-27+ |
| InChIKey | JOEMVXABUCVVMB-QVAGMWBUSA-N |
| XLogP | 5.61 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|