About (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine
(2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine (PubChem CID 129034983) has the molecular formula C10H17NO2S
and a molecular weight of 215.32 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine |
| PubChem CID | 129034983 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C(/C)S(=O)(=O)CC)CN |
| InChI | InChI=1S/C10H17NO2S/c1-4-10(8-11)7-6-9(3)14(12,13)5-2/h4,6-7H,1,5,8,11H2,2-3H3/b9-6+,10-7+ |
| InChIKey | DMPFHSSSJMFFDC-KZZDLZNXSA-N |
| XLogP | 1.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine?
The IUPAC name of (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine (CID 129034983) is (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine.
What is the SMILES notation for (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine?
The canonical SMILES for (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine is C=C/C(=C\C=C(/C)S(=O)(=O)CC)CN.
What is the InChIKey of (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine?
The InChIKey is DMPFHSSSJMFFDC-KZZDLZNXSA-N. The full InChI is InChI=1S/C10H17NO2S/c1-4-10(8-11)7-6-9(3)14(12,13)5-2/h4,6-7H,1,5,8,11H2,2-3H3/b9-6+,10-7+.
What are the key properties of (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine?
(2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine has a molecular weight of 215.32 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-2-ethenyl-5-ethylsulfonylhexa-2,4-dien-1-amine is sourced from PubChem (CID 129034983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).