About (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine
(4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine (PubChem CID 129035101) has the molecular formula C8H14INO
and a molecular weight of 267.11 g/mol. Its IUPAC name is (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine |
| PubChem CID | 129035101 |
| Molecular Formula | C8H14INO |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine |
| SMILES | C=C(C)[C@H]1COC(C)(C)N1I |
| InChI | InChI=1S/C8H14INO/c1-6(2)7-5-11-8(3,4)10(7)9/h7H,1,5H2,2-4H3/t7-/m1/s1 |
| InChIKey | NNFIMRZGWHIZIG-SSDOTTSWSA-N |
| XLogP | 2.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine?
The IUPAC name of (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine (CID 129035101) is (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine.
What is the SMILES notation for (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine?
The canonical SMILES for (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine is C=C(C)[C@H]1COC(C)(C)N1I.
What is the InChIKey of (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine?
The InChIKey is NNFIMRZGWHIZIG-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14INO/c1-6(2)7-5-11-8(3,4)10(7)9/h7H,1,5H2,2-4H3/t7-/m1/s1.
What are the key properties of (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine?
(4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine has a molecular weight of 267.11 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-iodo-2,2-dimethyl-4-prop-1-en-2-yl-1,3-oxazolidine is sourced from PubChem (CID 129035101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).