C16H23N — CID 129035115
N-[(4Z,6Z)-8-(1,2-dimethylcyclopropyl)-3-methylideneocta-1,4,6-trien-2-yl]ethanimine (PubChem CID 129035115) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N-[(4Z,6Z)-8-(1,2-dimethylcyclopropyl)-3-methylideneocta-1,4,6-trien-2-yl]ethanimine.
| Compound Name | N-[(4Z,6Z)-8-(1,2-dimethylcyclopropyl)-3-methylideneocta-1,4,6-trien-2-yl]ethanimine |
|---|---|
| PubChem CID | 129035115 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-[(4Z,6Z)-8-(1,2-dimethylcyclopropyl)-3-methylideneocta-1,4,6-trien-2-yl]ethanimine |
| SMILES | C=C(/C=C\C=C/CC1(C)CC1C)C(=C)/N=C/C |
| InChI | InChI=1S/C16H23N/c1-6-17-15(4)13(2)10-8-7-9-11-16(5)12-14(16)3/h6-10,14H,2,4,11-12H2,1,3,5H3/b9-7-,10-8-,17-6+ |
| InChIKey | BUEKAQBCFRUQBJ-AWYOFUELSA-N |
| XLogP | 4.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|