C24H26FNO6 — CID 129035308
3-[(2R,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanoyl]-5,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 129035308) has the molecular formula C24H26FNO6 and a molecular weight of 443.47 g/mol. Its IUPAC name is 3-[(2R,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanoyl]-5,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2R,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanoyl]-5,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129035308 |
| Molecular Formula | C24H26FNO6 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-[(2R,3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-3-hydroxy-2-methylpropanoyl]-5,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H](O)[C@@](C)(F)C(=O)N2CC(c3ccccc3)(c3ccccc3)OC2=O)O1 |
| InChI | InChI=1S/C24H26FNO6/c1-22(2)30-14-18(31-22)19(27)23(3,25)20(28)26-15-24(32-21(26)29,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18-19,27H,14-15H2,1-3H3/t18-,19-,23-/m1/s1 |
| InChIKey | NFXNTGHWYHTFEM-DNVFCKCGSA-N |
| XLogP | 3.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |