C22H24F6 — CID 129035319
1,2,4-trifluoro-3,5-di(propan-2-yl)-6-(2,3,5-trifluoro-4-methyl-6-propan-2-ylphenyl)benzene (PubChem CID 129035319) has the molecular formula C22H24F6 and a molecular weight of 402.42 g/mol. Its IUPAC name is 1,2,4-trifluoro-3,5-di(propan-2-yl)-6-(2,3,5-trifluoro-4-methyl-6-propan-2-ylphenyl)benzene.
| Compound Name | 1,2,4-trifluoro-3,5-di(propan-2-yl)-6-(2,3,5-trifluoro-4-methyl-6-propan-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 129035319 |
| Molecular Formula | C22H24F6 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1,2,4-trifluoro-3,5-di(propan-2-yl)-6-(2,3,5-trifluoro-4-methyl-6-propan-2-ylphenyl)benzene |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(F)c(C(C)C)c(F)c2C(C)C)c(C(C)C)c1F |
| InChI | InChI=1S/C22H24F6/c1-8(2)12-15(21(27)18(24)11(7)17(12)23)16-13(9(3)4)19(25)14(10(5)6)20(26)22(16)28/h8-10H,1-7H3 |
| InChIKey | UPJAFDHVDIUVAR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|