About 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine
4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine (PubChem CID 129035483) has the molecular formula C21H42N2O
and a molecular weight of 338.58 g/mol. Its IUPAC name is 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine |
| PubChem CID | 129035483 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine |
| SMILES | CC(C)(C)N1C(C)(C)CCCC1(C)CCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C21H42N2O/c1-18(2,3)23-20(6,7)10-9-11-21(23,8)13-12-19(4,5)22-14-16-24-17-15-22/h9-17H2,1-8H3 |
| InChIKey | FVBIXGVBJAQETR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine?
The IUPAC name of 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine (CID 129035483) is 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine.
What is the SMILES notation for 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine?
The canonical SMILES for 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine is CC(C)(C)N1C(C)(C)CCCC1(C)CCC(C)(C)N1CCOCC1.
What is the InChIKey of 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine?
The InChIKey is FVBIXGVBJAQETR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N2O/c1-18(2,3)23-20(6,7)10-9-11-21(23,8)13-12-19(4,5)22-14-16-24-17-15-22/h9-17H2,1-8H3.
What are the key properties of 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine?
4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine has a molecular weight of 338.58 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1-tert-butyl-2,6,6-trimethylpiperidin-2-yl)-2-methylbutan-2-yl]morpholine is sourced from PubChem (CID 129035483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).