C36H35NO2P2+2 — CID 129036863
(10aS)-1,1-bis(2-methoxyphenyl)-10,10-diphenyl-2,3,4,10a-tetrahydro-[1,3]azaphosphinino[1,2-a][1,3]benzazaphosphole-1,10-diium (PubChem CID 129036863) has the molecular formula C36H35NO2P2+2 and a molecular weight of 575.63 g/mol. Its IUPAC name is (10aS)-1,1-bis(2-methoxyphenyl)-10,10-diphenyl-2,3,4,10a-tetrahydro-[1,3]azaphosphinino[1,2-a][1,3]benzazaphosphole-1,10-diium.
| Compound Name | (10aS)-1,1-bis(2-methoxyphenyl)-10,10-diphenyl-2,3,4,10a-tetrahydro-[1,3]azaphosphinino[1,2-a][1,3]benzazaphosphole-1,10-diium |
|---|---|
| PubChem CID | 129036863 |
| Molecular Formula | C36H35NO2P2+2 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | (10aS)-1,1-bis(2-methoxyphenyl)-10,10-diphenyl-2,3,4,10a-tetrahydro-[1,3]azaphosphinino[1,2-a][1,3]benzazaphosphole-1,10-diium |
| SMILES | COc1ccccc1[P+]1(c2ccccc2OC)CCCN2c3ccccc3[P+](c3ccccc3)(c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C36H35NO2P2/c1-38-31-21-10-13-24-34(31)40(35-25-14-11-22-32(35)39-2)27-15-26-37-30-20-9-12-23-33(30)41(36(37)40,28-16-5-3-6-17-28)29-18-7-4-8-19-29/h3-14,16-25,36H,15,26-27H2,1-2H3/q+2/t36-/m0/s1 |
| InChIKey | HJUXRMXJBVSJCI-BHVANESWSA-N |
| XLogP | 6.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|