About (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol
(3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol (PubChem CID 129037001) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol |
| PubChem CID | 129037001 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol |
| SMILES | [H]/N=C(\N1CC[C@@H](O)C1)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O/c1-9(2,3)8(10)11-5-4-7(12)6-11/h7,10,12H,4-6H2,1-3H3/b10-8-/t7-/m1/s1 |
| InChIKey | VWJPSGQUFQPHBT-JAGWFPCYSA-N |
| XLogP | 1.08 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol?
The IUPAC name of (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol (CID 129037001) is (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol.
What is the SMILES notation for (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol?
The canonical SMILES for (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol is [H]/N=C(\N1CC[C@@H](O)C1)C(C)(C)C.
What is the InChIKey of (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol?
The InChIKey is VWJPSGQUFQPHBT-JAGWFPCYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-9(2,3)8(10)11-5-4-7(12)6-11/h7,10,12H,4-6H2,1-3H3/b10-8-/t7-/m1/s1.
What are the key properties of (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol?
(3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol has a molecular weight of 170.26 g/mol, XLogP of 1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,2-dimethylpropanimidoyl)pyrrolidin-3-ol is sourced from PubChem (CID 129037001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).