C10H19NO — CID 129037009
(3R)-1-(3,3-dimethylbut-1-en-2-yl)pyrrolidin-3-ol (PubChem CID 129037009) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (3R)-1-(3,3-dimethylbut-1-en-2-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(3,3-dimethylbut-1-en-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129037009 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (3R)-1-(3,3-dimethylbut-1-en-2-yl)pyrrolidin-3-ol |
| SMILES | C=C(N1CC[C@@H](O)C1)C(C)(C)C |
| InChI | InChI=1S/C10H19NO/c1-8(10(2,3)4)11-6-5-9(12)7-11/h9,12H,1,5-7H2,2-4H3/t9-/m1/s1 |
| InChIKey | CAMFMJXAANWXFJ-SECBINFHSA-N |
| XLogP | 1.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |