C11H7BrF9NO — CID 129037154
2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-methylaniline (PubChem CID 129037154) has the molecular formula C11H7BrF9NO and a molecular weight of 420.07 g/mol. Its IUPAC name is 2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-methylaniline.
| Compound Name | 2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-methylaniline |
|---|---|
| PubChem CID | 129037154 |
| Molecular Formula | C11H7BrF9NO |
| Molecular Weight | 420.07 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-methylaniline |
| SMILES | CNc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C11H7BrF9NO/c1-22-7-5(12)2-4(3-6(7)23-8(13)14)9(15,10(16,17)18)11(19,20)21/h2-3,8,22H,1H3 |
| InChIKey | IOXJLDLJQGNBLZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.07 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |