About 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine
4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine (PubChem CID 129037526) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine.
Molecular Properties
| Compound Name | 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine |
| PubChem CID | 129037526 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine |
| SMILES | COCCC(C)(C)OCCC(C)(C)N(C)C |
| InChI | InChI=1S/C13H29NO2/c1-12(2,14(5)6)8-11-16-13(3,4)9-10-15-7/h8-11H2,1-7H3 |
| InChIKey | UCXVHGKESDZTRX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine?
The IUPAC name of 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine (CID 129037526) is 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine.
What is the SMILES notation for 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine?
The canonical SMILES for 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine is COCCC(C)(C)OCCC(C)(C)N(C)C.
What is the InChIKey of 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine?
The InChIKey is UCXVHGKESDZTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO2/c1-12(2,14(5)6)8-11-16-13(3,4)9-10-15-7/h8-11H2,1-7H3.
What are the key properties of 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine?
4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine has a molecular weight of 231.38 g/mol, XLogP of 2.55, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxy-2-methylbutan-2-yl)oxy-N,N,2-trimethylbutan-2-amine is sourced from PubChem (CID 129037526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).