C8H9Cl2NO2 — CID 129038123
(2E,4E,6E)-3,6-dichloro-4-nitroocta-2,4,6-triene (PubChem CID 129038123) has the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. Its IUPAC name is (2E,4E,6E)-3,6-dichloro-4-nitroocta-2,4,6-triene.
| Compound Name | (2E,4E,6E)-3,6-dichloro-4-nitroocta-2,4,6-triene |
|---|---|
| PubChem CID | 129038123 |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | (2E,4E,6E)-3,6-dichloro-4-nitroocta-2,4,6-triene |
| SMILES | C/C=C(Cl)\C=C(C(/Cl)=C\C)\[N+](=O)[O-] |
| InChI | InChI=1S/C8H9Cl2NO2/c1-3-6(9)5-8(11(12)13)7(10)4-2/h3-5H,1-2H3/b6-3+,7-4+,8-5+ |
| InChIKey | YYWPJPMGSVOJFL-GQFDIYCXSA-N |
| XLogP | 3.43 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|