About (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide
(Z)-3-amino-N'-prop-2-enylbut-2-enimidamide (PubChem CID 129040046) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide |
| PubChem CID | 129040046 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide |
| SMILES | C=CC/N=C(N)/C=C(/C)N |
| InChI | InChI=1S/C7H13N3/c1-3-4-10-7(9)5-6(2)8/h3,5H,1,4,8H2,2H3,(H2,9,10)/b6-5- |
| InChIKey | KTBDSHMCNQUXDJ-WAYWQWQTSA-N |
| XLogP | 0.39 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide?
The IUPAC name of (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide (CID 129040046) is (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide.
What is the SMILES notation for (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide?
The canonical SMILES for (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide is C=CC/N=C(N)/C=C(/C)N.
What is the InChIKey of (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide?
The InChIKey is KTBDSHMCNQUXDJ-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H13N3/c1-3-4-10-7(9)5-6(2)8/h3,5H,1,4,8H2,2H3,(H2,9,10)/b6-5-.
What are the key properties of (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide?
(Z)-3-amino-N'-prop-2-enylbut-2-enimidamide has a molecular weight of 139.20 g/mol, XLogP of 0.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N'-prop-2-enylbut-2-enimidamide is sourced from PubChem (CID 129040046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).