C29H30N2 — CID 129040049
6-cyclohepta-2,4,6-trien-1-yl-12-[(1E,3Z)-hexa-1,3,5-trienyl]-4,14-dimethyl-3,15-diazatricyclo[9.5.0.02,8]hexadeca-1(11),2,4,7,12,14-hexaene (PubChem CID 129040049) has the molecular formula C29H30N2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 6-cyclohepta-2,4,6-trien-1-yl-12-[(1E,3Z)-hexa-1,3,5-trienyl]-4,14-dimethyl-3,15-diazatricyclo[9.5.0.02,8]hexadeca-1(11),2,4,7,12,14-hexaene.
| Compound Name | 6-cyclohepta-2,4,6-trien-1-yl-12-[(1E,3Z)-hexa-1,3,5-trienyl]-4,14-dimethyl-3,15-diazatricyclo[9.5.0.02,8]hexadeca-1(11),2,4,7,12,14-hexaene |
|---|---|
| PubChem CID | 129040049 |
| Molecular Formula | C29H30N2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 6-cyclohepta-2,4,6-trien-1-yl-12-[(1E,3Z)-hexa-1,3,5-trienyl]-4,14-dimethyl-3,15-diazatricyclo[9.5.0.02,8]hexadeca-1(11),2,4,7,12,14-hexaene |
| SMILES | C=C/C=C\C=C\C1=CC(C)=NCC2=C1CCC1=CC(C3C=CC=CC=C3)C=C(C)N=C12 |
| InChI | InChI=1S/C29H30N2/c1-4-5-6-9-14-24-17-21(2)30-20-28-27(24)16-15-25-19-26(18-22(3)31-29(25)28)23-12-10-7-8-11-13-23/h4-14,17-19,23,26H,1,15-16,20H2,2-3H3/b6-5-,14-9+ |
| InChIKey | CBVCIXJPLFUYMK-HMLIUESASA-N |
| XLogP | 6.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|