C8H20O16P4 — CID 129040517
[(1R,2S,3S,4R,5S,6R)-2,3-dimethyl-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate (PubChem CID 129040517) has the molecular formula C8H20O16P4 and a molecular weight of 496.13 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S,6R)-2,3-dimethyl-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate.
| Compound Name | [(1R,2S,3S,4R,5S,6R)-2,3-dimethyl-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 129040517 |
| Molecular Formula | C8H20O16P4 |
| Molecular Weight | 496.13 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | [(1R,2S,3S,4R,5S,6R)-2,3-dimethyl-4,5,6-triphosphonooxycyclohexyl] dihydrogen phosphate |
| SMILES | C[C@H]1[C@H](C)[C@@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C8H20O16P4/c1-3-4(2)6(22-26(12,13)14)8(24-28(18,19)20)7(23-27(15,16)17)5(3)21-25(9,10)11/h3-8H,1-2H3,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20)/t3-,4-,5+,6+,7-,8+/m0/s1 |
| InChIKey | IJTMBDFPNSOJIX-RVVFJPCRSA-N |
| XLogP | -0.82 |
| TPSA | 267.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.13 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|