C11H20F2O2 — CID 129040629
1,2-difluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol (PubChem CID 129040629) has the molecular formula C11H20F2O2 and a molecular weight of 222.27 g/mol. Its IUPAC name is 1,2-difluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol.
| Compound Name | 1,2-difluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 129040629 |
| Molecular Formula | C11H20F2O2 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1,2-difluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol |
| SMILES | CC(C)C1CC(C(C)C)C(O)(F)C1(O)F |
| InChI | InChI=1S/C11H20F2O2/c1-6(2)8-5-9(7(3)4)11(13,15)10(8,12)14/h6-9,14-15H,5H2,1-4H3 |
| InChIKey | JDLLZTRYLIXSHH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |