About 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol
4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol (PubChem CID 129040636) has the molecular formula C11H21FO2
and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol.
Molecular Properties
| Compound Name | 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol |
| PubChem CID | 129040636 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol |
| SMILES | CC(C)C1C(O)C(O)C(C(C)C)C1F |
| InChI | InChI=1S/C11H21FO2/c1-5(2)7-9(12)8(6(3)4)11(14)10(7)13/h5-11,13-14H,1-4H3 |
| InChIKey | XDIWBKHHVWAYAS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol?
The IUPAC name of 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol (CID 129040636) is 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol.
What is the SMILES notation for 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol?
The canonical SMILES for 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol is CC(C)C1C(O)C(O)C(C(C)C)C1F.
What is the InChIKey of 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol?
The InChIKey is XDIWBKHHVWAYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21FO2/c1-5(2)7-9(12)8(6(3)4)11(14)10(7)13/h5-11,13-14H,1-4H3.
What are the key properties of 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol?
4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol has a molecular weight of 204.28 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3,5-di(propan-2-yl)cyclopentane-1,2-diol is sourced from PubChem (CID 129040636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).