C27H32N2O6 — CID 129040913
methyl 2-[3,6-dimethyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-7-nitro-1H-indol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 129040913) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl 2-[3,6-dimethyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-7-nitro-1H-indol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl 2-[3,6-dimethyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-7-nitro-1H-indol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 129040913 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | methyl 2-[3,6-dimethyl-4-(5-methyl-3,4-dihydro-2H-chromen-6-yl)-7-nitro-1H-indol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)C(OC(C)(C)C)c1c(C)c([N+](=O)[O-])c2[nH]cc(C)c2c1-c1ccc2c(c1C)CCCO2 |
| InChI | InChI=1S/C27H32N2O6/c1-14-13-28-23-20(14)22(18-10-11-19-17(15(18)2)9-8-12-34-19)21(16(3)24(23)29(31)32)25(26(30)33-7)35-27(4,5)6/h10-11,13,25,28H,8-9,12H2,1-7H3 |
| InChIKey | IYJOFUUACAYBHC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|