C12H17F2N3 — CID 129041434
4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2,3-dihydro-1H-triazole (PubChem CID 129041434) has the molecular formula C12H17F2N3 and a molecular weight of 241.28 g/mol. Its IUPAC name is 4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2,3-dihydro-1H-triazole.
| Compound Name | 4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2,3-dihydro-1H-triazole |
|---|---|
| PubChem CID | 129041434 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3,5-trien-3-yl]-2,3-dihydro-1H-triazole |
| SMILES | C=C/C(C)=C(\C=C)C1=C(C(F)(F)CC)NNN1 |
| InChI | InChI=1S/C12H17F2N3/c1-5-8(4)9(6-2)10-11(16-17-15-10)12(13,14)7-3/h5-6,15-17H,1-2,7H2,3-4H3/b9-8+ |
| InChIKey | FRRLCPPLSDEHGA-CMDGGOBGSA-N |
| XLogP | 2.54 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|