About (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine
(2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine (PubChem CID 129041517) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine |
| PubChem CID | 129041517 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C(/C=C\C(C)=C/C)N1CCCC1 |
| InChI | InChI=1S/C11H18N2/c1-3-10(2)6-7-11(12)13-8-4-5-9-13/h3,6-7,12H,4-5,8-9H2,1-2H3/b7-6-,10-3-,12-11- |
| InChIKey | BVWWSHIYTJREMC-MOGIMUFPSA-N |
| XLogP | 2.58 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine?
The IUPAC name of (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine (CID 129041517) is (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine.
What is the SMILES notation for (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine?
The canonical SMILES for (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine is [H]/N=C(/C=C\C(C)=C/C)N1CCCC1.
What is the InChIKey of (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine?
The InChIKey is BVWWSHIYTJREMC-MOGIMUFPSA-N. The full InChI is InChI=1S/C11H18N2/c1-3-10(2)6-7-11(12)13-8-4-5-9-13/h3,6-7,12H,4-5,8-9H2,1-2H3/b7-6-,10-3-,12-11-.
What are the key properties of (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine?
(2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine has a molecular weight of 178.28 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-4-methyl-1-pyrrolidin-1-ylhexa-2,4-dien-1-imine is sourced from PubChem (CID 129041517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).