C12H17NS — CID 129041776
(1Z,3E,5Z,6Z)-5-ethylidene-2-methyl-7-(methylideneamino)octa-1,3,6-triene-1-thiol (PubChem CID 129041776) has the molecular formula C12H17NS and a molecular weight of 207.34 g/mol. Its IUPAC name is (1Z,3E,5Z,6Z)-5-ethylidene-2-methyl-7-(methylideneamino)octa-1,3,6-triene-1-thiol.
| Compound Name | (1Z,3E,5Z,6Z)-5-ethylidene-2-methyl-7-(methylideneamino)octa-1,3,6-triene-1-thiol |
|---|---|
| PubChem CID | 129041776 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (1Z,3E,5Z,6Z)-5-ethylidene-2-methyl-7-(methylideneamino)octa-1,3,6-triene-1-thiol |
| SMILES | C=N/C(C)=C\C(=C/C)\C=C\C(C)=C/S |
| InChI | InChI=1S/C12H17NS/c1-5-12(8-11(3)13-4)7-6-10(2)9-14/h5-9,14H,4H2,1-3H3/b7-6+,10-9-,11-8-,12-5- |
| InChIKey | MLBOUNXYUPVCGI-SBARDMPISA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|