C22H14F3N3OS — CID 129042285
4-[[4-[(2,6-difluorophenyl)methyl]-3-oxo-1,2,4-benzothiadiazin-2-yl]methyl]-2-fluorobenzonitrile (PubChem CID 129042285) has the molecular formula C22H14F3N3OS and a molecular weight of 425.44 g/mol. Its IUPAC name is 4-[[4-[(2,6-difluorophenyl)methyl]-3-oxo-1,2,4-benzothiadiazin-2-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 4-[[4-[(2,6-difluorophenyl)methyl]-3-oxo-1,2,4-benzothiadiazin-2-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 129042285 |
| Molecular Formula | C22H14F3N3OS |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-[[4-[(2,6-difluorophenyl)methyl]-3-oxo-1,2,4-benzothiadiazin-2-yl]methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CN2Sc3ccccc3N(Cc3c(F)cccc3F)C2=O)cc1F |
| InChI | InChI=1S/C22H14F3N3OS/c23-17-4-3-5-18(24)16(17)13-27-20-6-1-2-7-21(20)30-28(22(27)29)12-14-8-9-15(11-26)19(25)10-14/h1-10H,12-13H2 |
| InChIKey | DKJAILKFVKRWPG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|