C21H16ClFN2OS — CID 129042373
4-(2-chloro-6-fluorophenyl)-2-(2,4-dimethylphenyl)-1,2,4-benzothiadiazin-3-one (PubChem CID 129042373) has the molecular formula C21H16ClFN2OS and a molecular weight of 398.89 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-2-(2,4-dimethylphenyl)-1,2,4-benzothiadiazin-3-one.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-2-(2,4-dimethylphenyl)-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 129042373 |
| Molecular Formula | C21H16ClFN2OS |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-2-(2,4-dimethylphenyl)-1,2,4-benzothiadiazin-3-one |
| SMILES | Cc1ccc(N2Sc3ccccc3N(c3c(F)cccc3Cl)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H16ClFN2OS/c1-13-10-11-17(14(2)12-13)25-21(26)24(18-8-3-4-9-19(18)27-25)20-15(22)6-5-7-16(20)23/h3-12H,1-2H3 |
| InChIKey | HLXUANRZTIQWEQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|