C19H21N4O6S- — CID 129042781
1-(2-methoxypyridine-4-carbonyl)-4-[2-methoxy-4-(sulfinatoamino)benzoyl]piperazine (PubChem CID 129042781) has the molecular formula C19H21N4O6S- and a molecular weight of 433.47 g/mol. Its IUPAC name is 1-(2-methoxypyridine-4-carbonyl)-4-[2-methoxy-4-(sulfinatoamino)benzoyl]piperazine.
| Compound Name | 1-(2-methoxypyridine-4-carbonyl)-4-[2-methoxy-4-(sulfinatoamino)benzoyl]piperazine |
|---|---|
| PubChem CID | 129042781 |
| Molecular Formula | C19H21N4O6S- |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-(2-methoxypyridine-4-carbonyl)-4-[2-methoxy-4-(sulfinatoamino)benzoyl]piperazine |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3ccc(NS(=O)[O-])cc3OC)CC2)ccn1 |
| InChI | InChI=1S/C19H22N4O6S/c1-28-16-12-14(21-30(26)27)3-4-15(16)19(25)23-9-7-22(8-10-23)18(24)13-5-6-20-17(11-13)29-2/h3-6,11-12,21H,7-10H2,1-2H3,(H,26,27)/p-1 |
| InChIKey | LSJQWTBGVAUELA-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|