C19H18F3N4O5S- — CID 129042827
1-[3-methoxy-4-(sulfinatoamino)benzoyl]-4-[2-(trifluoromethyl)pyridine-3-carbonyl]piperazine (PubChem CID 129042827) has the molecular formula C19H18F3N4O5S- and a molecular weight of 471.44 g/mol. Its IUPAC name is 1-[3-methoxy-4-(sulfinatoamino)benzoyl]-4-[2-(trifluoromethyl)pyridine-3-carbonyl]piperazine.
| Compound Name | 1-[3-methoxy-4-(sulfinatoamino)benzoyl]-4-[2-(trifluoromethyl)pyridine-3-carbonyl]piperazine |
|---|---|
| PubChem CID | 129042827 |
| Molecular Formula | C19H18F3N4O5S- |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 1-[3-methoxy-4-(sulfinatoamino)benzoyl]-4-[2-(trifluoromethyl)pyridine-3-carbonyl]piperazine |
| SMILES | COc1cc(C(=O)N2CCN(C(=O)c3cccnc3C(F)(F)F)CC2)ccc1NS(=O)[O-] |
| InChI | InChI=1S/C19H19F3N4O5S/c1-31-15-11-12(4-5-14(15)24-32(29)30)17(27)25-7-9-26(10-8-25)18(28)13-3-2-6-23-16(13)19(20,21)22/h2-6,11,24H,7-10H2,1H3,(H,29,30)/p-1 |
| InChIKey | CMIMPNLAUDDFAT-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|