C36H43F3N4O3S — CID 129042966
3-cyclodecyl-2-(ethylideneamino)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]benzenesulfonamide (PubChem CID 129042966) has the molecular formula C36H43F3N4O3S and a molecular weight of 668.83 g/mol. Its IUPAC name is 3-cyclodecyl-2-(ethylideneamino)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]benzenesulfonamide.
| Compound Name | 3-cyclodecyl-2-(ethylideneamino)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129042966 |
| Molecular Formula | C36H43F3N4O3S |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 3-cyclodecyl-2-(ethylideneamino)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbonyl]phenyl]benzenesulfonamide |
| SMILES | C/C=N/c1c(C2CCCCCCCCC2)cccc1S(=O)(=O)Nc1ccc(C(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C36H43F3N4O3S/c1-2-40-34-32(27-12-8-6-4-3-5-7-9-13-27)16-11-17-33(34)47(45,46)41-30-20-18-28(19-21-30)35(44)43-24-22-42(23-25-43)31-15-10-14-29(26-31)36(37,38)39/h2,10-11,14-21,26-27,41H,3-9,12-13,22-25H2,1H3/b40-2+ |
| InChIKey | HCMPFRDANADSNL-ZFMLXWAGSA-N |
| XLogP | 8.80 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|