C5H13N3 — CID 129043653
1,4,5-trimethyl-1,2,4-triazolidine (PubChem CID 129043653) has the molecular formula C5H13N3 and a molecular weight of 115.18 g/mol. Its IUPAC name is 1,4,5-trimethyl-1,2,4-triazolidine.
| Compound Name | 1,4,5-trimethyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 129043653 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 1,4,5-trimethyl-1,2,4-triazolidine |
| SMILES | CC1N(C)CNN1C |
| InChI | InChI=1S/C5H13N3/c1-5-7(2)4-6-8(5)3/h5-6H,4H2,1-3H3 |
| InChIKey | VPYBMYJATVIZFP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |