C12H19N3O — CID 129043658
N-butyl-3-(pyridin-4-ylamino)propanamide (PubChem CID 129043658) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is N-butyl-3-(pyridin-4-ylamino)propanamide.
| Compound Name | N-butyl-3-(pyridin-4-ylamino)propanamide |
|---|---|
| PubChem CID | 129043658 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-butyl-3-(pyridin-4-ylamino)propanamide |
| SMILES | CCCCNC(=O)CCNc1ccncc1 |
| InChI | InChI=1S/C12H19N3O/c1-2-3-7-15-12(16)6-10-14-11-4-8-13-9-5-11/h4-5,8-9H,2-3,6-7,10H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | RVCBOIGTFVFCAP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|