C9H6F3N3O2 — CID 12904381
4-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 12904381) has the molecular formula C9H6F3N3O2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 12904381 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H6F3N3O2/c10-9(11,12)5-1-3-6(4-2-5)15-7(16)13-14-8(15)17/h1-4H,(H,13,16)(H,14,17) |
| InChIKey | NTTKKHVOZSBQJG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |