C14H26N2O — CID 129043981
[(4R,9Z)-1,4-dimethyl-1-azacycloundeca-5,9-dien-4-yl]-(methylamino)methanol (PubChem CID 129043981) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is [(4R,9Z)-1,4-dimethyl-1-azacycloundeca-5,9-dien-4-yl]-(methylamino)methanol.
| Compound Name | [(4R,9Z)-1,4-dimethyl-1-azacycloundeca-5,9-dien-4-yl]-(methylamino)methanol |
|---|---|
| PubChem CID | 129043981 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | [(4R,9Z)-1,4-dimethyl-1-azacycloundeca-5,9-dien-4-yl]-(methylamino)methanol |
| SMILES | CNC(O)[C@@]1(C)C=CCC/C=C\CN(C)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-14(13(17)15-2)9-7-5-4-6-8-11-16(3)12-10-14/h6-9,13,15,17H,4-5,10-12H2,1-3H3/b8-6-,9-7?/t13?,14-/m0/s1 |
| InChIKey | NVLHTUHBGJAJJT-QUUIRMHCSA-N |
| XLogP | 1.76 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|