C17H28F2N8 — CID 129044714
(Z)-2-[amino(methyl)amino]-N'-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]prop-1-ene-1,3-diamine (PubChem CID 129044714) has the molecular formula C17H28F2N8 and a molecular weight of 382.46 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-N'-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-N'-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 129044714 |
| Molecular Formula | C17H28F2N8 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-N'-[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]prop-1-ene-1,3-diamine |
| SMILES | [H]/N=C/c1c(NC/C(=C/N)N(C)N)nc(C(C)(C)C)nc1N1CCC(F)(F)C1 |
| InChI | InChI=1S/C17H28F2N8/c1-16(2,3)15-24-13(23-9-11(7-20)26(4)22)12(8-21)14(25-15)27-6-5-17(18,19)10-27/h7-8,21H,5-6,9-10,20,22H2,1-4H3,(H,23,24,25)/b11-7-,21-8+ |
| InChIKey | WTZFGZGHMJAOEW-WAQANLESSA-N |
| XLogP | 1.63 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|