C18H28F2N8 — CID 129044724
N-amino-2-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-N-cyclopropylethanimidamide (PubChem CID 129044724) has the molecular formula C18H28F2N8 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-amino-2-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-N-cyclopropylethanimidamide.
| Compound Name | N-amino-2-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-N-cyclopropylethanimidamide |
|---|---|
| PubChem CID | 129044724 |
| Molecular Formula | C18H28F2N8 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-amino-2-[[2-tert-butyl-6-(3,3-difluoropyrrolidin-1-yl)-5-methanimidoylpyrimidin-4-yl]amino]-N-cyclopropylethanimidamide |
| SMILES | [H]/N=C(/CNc1nc(C(C)(C)C)nc(N2CCC(F)(F)C2)c1/C=N/[H])N(N)C1CC1 |
| InChI | InChI=1S/C18H28F2N8/c1-17(2,3)16-25-14(24-9-13(22)28(23)11-4-5-11)12(8-21)15(26-16)27-7-6-18(19,20)10-27/h8,11,21-22H,4-7,9-10,23H2,1-3H3,(H,24,25,26)/b21-8+,22-13- |
| InChIKey | FXNUNYZFMCPNAD-DBVQGPIVSA-N |
| XLogP | 2.34 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|