About 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone
1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone (PubChem CID 129044728) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone |
| PubChem CID | 129044728 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone |
| SMILES | COC1C(C)OC(C)[C@H](OC)C1C(C)=O |
| InChI | InChI=1S/C11H20O4/c1-6(12)9-10(13-4)7(2)15-8(3)11(9)14-5/h7-11H,1-5H3/t7?,8?,9?,10-,11?/m0/s1 |
| InChIKey | QVVIYRWRBGAZDD-UIVJTFTRSA-N |
| XLogP | 1.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone?
The IUPAC name of 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone (CID 129044728) is 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone.
What is the SMILES notation for 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone?
The canonical SMILES for 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone is COC1C(C)OC(C)[C@H](OC)C1C(C)=O.
What is the InChIKey of 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone?
The InChIKey is QVVIYRWRBGAZDD-UIVJTFTRSA-N. The full InChI is InChI=1S/C11H20O4/c1-6(12)9-10(13-4)7(2)15-8(3)11(9)14-5/h7-11H,1-5H3/t7?,8?,9?,10-,11?/m0/s1.
What are the key properties of 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone?
1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone has a molecular weight of 216.28 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3,5-dimethoxy-2,6-dimethyloxan-4-yl]ethanone is sourced from PubChem (CID 129044728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).