About 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine
2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine (PubChem CID 129045387) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine |
| PubChem CID | 129045387 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine |
| SMILES | CCC(C)NC(CC)CN(C)C |
| InChI | InChI=1S/C10H24N2/c1-6-9(3)11-10(7-2)8-12(4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | XKHPZMCXRWFLEQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine?
The IUPAC name of 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine (CID 129045387) is 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine.
What is the SMILES notation for 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine?
The canonical SMILES for 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine is CCC(C)NC(CC)CN(C)C.
What is the InChIKey of 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine?
The InChIKey is XKHPZMCXRWFLEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-6-9(3)11-10(7-2)8-12(4)5/h9-11H,6-8H2,1-5H3.
What are the key properties of 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine?
2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine has a molecular weight of 172.32 g/mol, XLogP of 1.71, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-butan-2-yl-1-N,1-N-dimethylbutane-1,2-diamine is sourced from PubChem (CID 129045387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).