About 8-pyridin-3-yloctanoic acid;hydrochloride
8-pyridin-3-yloctanoic acid;hydrochloride (PubChem CID 12904565) has the molecular formula C13H20ClNO2
and a molecular weight of 257.76 g/mol. Its IUPAC name is 8-pyridin-3-yloctanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 8-pyridin-3-yloctanoic acid;hydrochloride |
| PubChem CID | 12904565 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 8-pyridin-3-yloctanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCCCCc1cccnc1 |
| InChI | InChI=1S/C13H19NO2.ClH/c15-13(16)9-5-3-1-2-4-7-12-8-6-10-14-11-12;/h6,8,10-11H,1-5,7,9H2,(H,15,16);1H |
| InChIKey | ARKHPOIXSWHQFC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-pyridin-3-yloctanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyridin-3-yloctanoic acid;hydrochloride?
The IUPAC name of 8-pyridin-3-yloctanoic acid;hydrochloride (CID 12904565) is 8-pyridin-3-yloctanoic acid;hydrochloride.
What is the SMILES notation for 8-pyridin-3-yloctanoic acid;hydrochloride?
The canonical SMILES for 8-pyridin-3-yloctanoic acid;hydrochloride is Cl.O=C(O)CCCCCCCc1cccnc1.
What is the InChIKey of 8-pyridin-3-yloctanoic acid;hydrochloride?
The InChIKey is ARKHPOIXSWHQFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.ClH/c15-13(16)9-5-3-1-2-4-7-12-8-6-10-14-11-12;/h6,8,10-11H,1-5,7,9H2,(H,15,16);1H.
What are the key properties of 8-pyridin-3-yloctanoic acid;hydrochloride?
8-pyridin-3-yloctanoic acid;hydrochloride has a molecular weight of 257.76 g/mol, XLogP of 3.47, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyridin-3-yloctanoic acid;hydrochloride is sourced from PubChem (CID 12904565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).