C10H19N3 — CID 129045666
N-(2,3-dihydropyridin-6-yl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 129045666) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-6-yl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-(2,3-dihydropyridin-6-yl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 129045666 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-(2,3-dihydropyridin-6-yl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNC1=NCCC=C1 |
| InChI | InChI=1S/C10H19N3/c1-9(2)11-7-8-13-10-5-3-4-6-12-10/h3,5,9,11H,4,6-8H2,1-2H3,(H,12,13) |
| InChIKey | JZGBBKJNKGOYJF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|