C15H20FN3O2 — CID 129045894
[3-[(1Z,3E)-1,4-diamino-4-morpholin-4-ylbuta-1,3-dienyl]-2-fluorophenyl]methanol (PubChem CID 129045894) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is [3-[(1Z,3E)-1,4-diamino-4-morpholin-4-ylbuta-1,3-dienyl]-2-fluorophenyl]methanol.
| Compound Name | [3-[(1Z,3E)-1,4-diamino-4-morpholin-4-ylbuta-1,3-dienyl]-2-fluorophenyl]methanol |
|---|---|
| PubChem CID | 129045894 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | [3-[(1Z,3E)-1,4-diamino-4-morpholin-4-ylbuta-1,3-dienyl]-2-fluorophenyl]methanol |
| SMILES | N/C(=C\C=C(/N)N1CCOCC1)c1cccc(CO)c1F |
| InChI | InChI=1S/C15H20FN3O2/c16-15-11(10-20)2-1-3-12(15)13(17)4-5-14(18)19-6-8-21-9-7-19/h1-5,20H,6-10,17-18H2/b13-4-,14-5+ |
| InChIKey | KBWBLGQDJXRKEB-YCKHSYMTSA-N |
| XLogP | 0.75 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|