About methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate
methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate (PubChem CID 129046104) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate |
| PubChem CID | 129046104 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate |
| SMILES | C=CC1=NCCC(C(=O)OC)=C1 |
| InChI | InChI=1S/C9H11NO2/c1-3-8-6-7(4-5-10-8)9(11)12-2/h3,6H,1,4-5H2,2H3 |
| InChIKey | MTYDKXYMNKQEMC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate?
The IUPAC name of methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate (CID 129046104) is methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate.
What is the SMILES notation for methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate?
The canonical SMILES for methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate is C=CC1=NCCC(C(=O)OC)=C1.
What is the InChIKey of methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate?
The InChIKey is MTYDKXYMNKQEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-3-8-6-7(4-5-10-8)9(11)12-2/h3,6H,1,4-5H2,2H3.
What are the key properties of methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate?
methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate has a molecular weight of 165.19 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-ethenyl-2,3-dihydropyridine-4-carboxylate is sourced from PubChem (CID 129046104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).