C23H40O6 — CID 129046145
2-[3-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxypropoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 129046145) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-[3-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxypropoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[3-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxypropoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129046145 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 2-[3-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxypropoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCCOC(=O)C1CCCCC1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C23H40O6/c1-21(2,3)15-23(7,22(4,5)6)20(27)29-14-10-13-28-19(26)17-12-9-8-11-16(17)18(24)25/h16-17H,8-15H2,1-7H3,(H,24,25) |
| InChIKey | KCQHZBAESNJRGU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|