C23H42O6 — CID 129046146
2-[3-[(2,4,4-trimethyl-2-propan-2-ylpentoxy)methoxy]propoxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 129046146) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-[3-[(2,4,4-trimethyl-2-propan-2-ylpentoxy)methoxy]propoxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[3-[(2,4,4-trimethyl-2-propan-2-ylpentoxy)methoxy]propoxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 129046146 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 2-[3-[(2,4,4-trimethyl-2-propan-2-ylpentoxy)methoxy]propoxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)C(C)(COCOCCCOC(=O)C1CCCCC1C(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C23H42O6/c1-17(2)23(6,14-22(3,4)5)15-28-16-27-12-9-13-29-21(26)19-11-8-7-10-18(19)20(24)25/h17-19H,7-16H2,1-6H3,(H,24,25) |
| InChIKey | OEEHEFSLUKQSHO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|