About 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate
2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate (PubChem CID 129046962) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate |
| PubChem CID | 129046962 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCc1cc2ccc1o2 |
| InChI | InChI=1S/C12H14O3/c1-8(2)12(13)14-6-5-9-7-10-3-4-11(9)15-10/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | OLIJRNCTXISTJA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate?
The IUPAC name of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate (CID 129046962) is 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate.
What is the SMILES notation for 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate?
The canonical SMILES for 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate is CC(C)C(=O)OCCc1cc2ccc1o2.
What is the InChIKey of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate?
The InChIKey is OLIJRNCTXISTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-8(2)12(13)14-6-5-9-7-10-3-4-11(9)15-10/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate?
2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate has a molecular weight of 206.24 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yl)ethyl 2-methylpropanoate is sourced from PubChem (CID 129046962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).