C29H36ClN5O3 — CID 129047472
3-(2-chloro-6-methoxyphenyl)-7-[[(1Z,3E)-4-[2-(diethylamino)ethoxy]-1-(methylideneamino)penta-1,3-dienyl]amino]-1-ethyl-1,6-naphthyridin-2-one (PubChem CID 129047472) has the molecular formula C29H36ClN5O3 and a molecular weight of 538.09 g/mol. Its IUPAC name is 3-(2-chloro-6-methoxyphenyl)-7-[[(1Z,3E)-4-[2-(diethylamino)ethoxy]-1-(methylideneamino)penta-1,3-dienyl]amino]-1-ethyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(2-chloro-6-methoxyphenyl)-7-[[(1Z,3E)-4-[2-(diethylamino)ethoxy]-1-(methylideneamino)penta-1,3-dienyl]amino]-1-ethyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 129047472 |
| Molecular Formula | C29H36ClN5O3 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 3-(2-chloro-6-methoxyphenyl)-7-[[(1Z,3E)-4-[2-(diethylamino)ethoxy]-1-(methylideneamino)penta-1,3-dienyl]amino]-1-ethyl-1,6-naphthyridin-2-one |
| SMILES | C=N/C(=C\C=C(/C)OCCN(CC)CC)Nc1cc2c(cn1)cc(-c1c(Cl)cccc1OC)c(=O)n2CC |
| InChI | InChI=1S/C29H36ClN5O3/c1-7-34(8-2)15-16-38-20(4)13-14-26(31-5)33-27-18-24-21(19-32-27)17-22(29(36)35(24)9-3)28-23(30)11-10-12-25(28)37-6/h10-14,17-19H,5,7-9,15-16H2,1-4,6H3,(H,32,33)/b20-13+,26-14+ |
| InChIKey | IZTRYNQVBPBNBG-OUDSLWFUSA-N |
| XLogP | 5.96 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|