C22H27Cl2N5O — CID 129047674
N-[(3R,4R)-4-(5-chlorocyclohexen-1-yl)piperidin-3-yl]-5-(4-chloro-1-methylpyrazol-5-yl)-4-methylpyridine-2-carboxamide (PubChem CID 129047674) has the molecular formula C22H27Cl2N5O and a molecular weight of 448.40 g/mol. Its IUPAC name is N-[(3R,4R)-4-(5-chlorocyclohexen-1-yl)piperidin-3-yl]-5-(4-chloro-1-methylpyrazol-5-yl)-4-methylpyridine-2-carboxamide.
| Compound Name | N-[(3R,4R)-4-(5-chlorocyclohexen-1-yl)piperidin-3-yl]-5-(4-chloro-1-methylpyrazol-5-yl)-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 129047674 |
| Molecular Formula | C22H27Cl2N5O |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(3R,4R)-4-(5-chlorocyclohexen-1-yl)piperidin-3-yl]-5-(4-chloro-1-methylpyrazol-5-yl)-4-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2CNCC[C@@H]2C2=CCCC(Cl)C2)ncc1-c1c(Cl)cnn1C |
| InChI | InChI=1S/C22H27Cl2N5O/c1-13-8-19(26-10-17(13)21-18(24)11-27-29(21)2)22(30)28-20-12-25-7-6-16(20)14-4-3-5-15(23)9-14/h4,8,10-11,15-16,20,25H,3,5-7,9,12H2,1-2H3,(H,28,30)/t15?,16-,20+/m1/s1 |
| InChIKey | ICOBMSLERPPZRY-ZHXBYJNYSA-N |
| XLogP | 3.87 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|