C32H38N4O4 — CID 129047819
(2S)-N'-tert-butyl-N-[2-[(3-phenylbenzoyl)amino]ethyl]-2-(3-phenylpropanoylamino)butanediamide (PubChem CID 129047819) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is (2S)-N'-tert-butyl-N-[2-[(3-phenylbenzoyl)amino]ethyl]-2-(3-phenylpropanoylamino)butanediamide.
| Compound Name | (2S)-N'-tert-butyl-N-[2-[(3-phenylbenzoyl)amino]ethyl]-2-(3-phenylpropanoylamino)butanediamide |
|---|---|
| PubChem CID | 129047819 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (2S)-N'-tert-butyl-N-[2-[(3-phenylbenzoyl)amino]ethyl]-2-(3-phenylpropanoylamino)butanediamide |
| SMILES | CC(C)(C)NC(=O)C[C@H](NC(=O)CCc1ccccc1)C(=O)NCCNC(=O)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C32H38N4O4/c1-32(2,3)36-29(38)22-27(35-28(37)18-17-23-11-6-4-7-12-23)31(40)34-20-19-33-30(39)26-16-10-15-25(21-26)24-13-8-5-9-14-24/h4-16,21,27H,17-20,22H2,1-3H3,(H,33,39)(H,34,40)(H,35,37)(H,36,38)/t27-/m0/s1 |
| InChIKey | ZMFRLEFFYGXGES-MHZLTWQESA-N |
| XLogP | 3.62 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|