About 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide
2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide (PubChem CID 1290492) has the molecular formula C16H15ClN2O6S
and a molecular weight of 398.82 g/mol. Its IUPAC name is 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide.
Molecular Properties
| Compound Name | 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide |
| PubChem CID | 1290492 |
| Molecular Formula | C16H15ClN2O6S |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)Nc2ccc3c(c2)OCO3)cc1OCC(N)=O |
| InChI | InChI=1S/C16H15ClN2O6S/c1-9-4-11(17)15(6-13(9)23-7-16(18)20)26(21,22)19-10-2-3-12-14(5-10)25-8-24-12/h2-6,19H,7-8H2,1H3,(H2,18,20) |
| InChIKey | YITVIHSEAXMHQD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide?
The IUPAC name of 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide (CID 1290492) is 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide.
What is the SMILES notation for 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide?
The canonical SMILES for 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide is Cc1cc(Cl)c(S(=O)(=O)Nc2ccc3c(c2)OCO3)cc1OCC(N)=O.
What is the InChIKey of 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide?
The InChIKey is YITVIHSEAXMHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN2O6S/c1-9-4-11(17)15(6-13(9)23-7-16(18)20)26(21,22)19-10-2-3-12-14(5-10)25-8-24-12/h2-6,19H,7-8H2,1H3,(H2,18,20).
What are the key properties of 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide?
2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide has a molecular weight of 398.82 g/mol, XLogP of 2.04, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,3-benzodioxol-5-ylsulfamoyl)-4-chloro-2-methylphenoxy]acetamide is sourced from PubChem (CID 1290492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).