C24H34N2 — CID 129049276
1-[4,7a-dimethyl-5-(2-methylpentan-2-yl)-3,3a,4,5,6,7-hexahydroinden-1-yl]benzimidazole (PubChem CID 129049276) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 1-[4,7a-dimethyl-5-(2-methylpentan-2-yl)-3,3a,4,5,6,7-hexahydroinden-1-yl]benzimidazole.
| Compound Name | 1-[4,7a-dimethyl-5-(2-methylpentan-2-yl)-3,3a,4,5,6,7-hexahydroinden-1-yl]benzimidazole |
|---|---|
| PubChem CID | 129049276 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 1-[4,7a-dimethyl-5-(2-methylpentan-2-yl)-3,3a,4,5,6,7-hexahydroinden-1-yl]benzimidazole |
| SMILES | CCCC(C)(C)C1CCC2(C)C(n3cnc4ccccc43)=CCC2C1C |
| InChI | InChI=1S/C24H34N2/c1-6-14-23(3,4)18-13-15-24(5)19(17(18)2)11-12-22(24)26-16-25-20-9-7-8-10-21(20)26/h7-10,12,16-19H,6,11,13-15H2,1-5H3 |
| InChIKey | RNLGFNKFYRGUBR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |