C31H45N — CID 129049584
N-ethyl-4-[3-[(3E)-6-(4-ethyl-2,5-dimethylphenyl)-3,4-dimethylhexa-1,3-dien-2-yl]-2-methylphenyl]butan-1-amine (PubChem CID 129049584) has the molecular formula C31H45N and a molecular weight of 431.71 g/mol. Its IUPAC name is N-ethyl-4-[3-[(3E)-6-(4-ethyl-2,5-dimethylphenyl)-3,4-dimethylhexa-1,3-dien-2-yl]-2-methylphenyl]butan-1-amine.
| Compound Name | N-ethyl-4-[3-[(3E)-6-(4-ethyl-2,5-dimethylphenyl)-3,4-dimethylhexa-1,3-dien-2-yl]-2-methylphenyl]butan-1-amine |
|---|---|
| PubChem CID | 129049584 |
| Molecular Formula | C31H45N |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.36 |
| IUPAC Name | N-ethyl-4-[3-[(3E)-6-(4-ethyl-2,5-dimethylphenyl)-3,4-dimethylhexa-1,3-dien-2-yl]-2-methylphenyl]butan-1-amine |
| SMILES | C=C(/C(C)=C(\C)CCc1cc(C)c(CC)cc1C)c1cccc(CCCCNCC)c1C |
| InChI | InChI=1S/C31H45N/c1-9-28-20-24(5)30(21-23(28)4)18-17-22(3)25(6)26(7)31-16-13-15-29(27(31)8)14-11-12-19-32-10-2/h13,15-16,20-21,32H,7,9-12,14,17-19H2,1-6,8H3/b25-22+ |
| InChIKey | VBJPYRRPELJJOJ-YYDJUVGSSA-N |
| XLogP | 8.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|