About 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene
1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene (PubChem CID 129049604) has the molecular formula C26H27Cl
and a molecular weight of 374.96 g/mol. Its IUPAC name is 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene.
Molecular Properties
| Compound Name | 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene |
| PubChem CID | 129049604 |
| Molecular Formula | C26H27Cl |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene |
| SMILES | C=Cc1cc(CCc2cccc(-c3cccc(C)c3C)c2C)c(Cl)cc1C |
| InChI | InChI=1S/C26H27Cl/c1-6-21-16-23(26(27)15-18(21)3)14-13-22-10-8-12-25(20(22)5)24-11-7-9-17(2)19(24)4/h6-12,15-16H,1,13-14H2,2-5H3 |
| InChIKey | ZGLMREUVJXSFPF-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene?
The IUPAC name of 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene (CID 129049604) is 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene.
What is the SMILES notation for 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene?
The canonical SMILES for 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene is C=Cc1cc(CCc2cccc(-c3cccc(C)c3C)c2C)c(Cl)cc1C.
What is the InChIKey of 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene?
The InChIKey is ZGLMREUVJXSFPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27Cl/c1-6-21-16-23(26(27)15-18(21)3)14-13-22-10-8-12-25(20(22)5)24-11-7-9-17(2)19(24)4/h6-12,15-16H,1,13-14H2,2-5H3.
What are the key properties of 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene?
1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene has a molecular weight of 374.96 g/mol, XLogP of 7.67, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-[2-[3-(2,3-dimethylphenyl)-2-methylphenyl]ethyl]-4-ethenyl-5-methylbenzene is sourced from PubChem (CID 129049604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).