C29H39NO2 — CID 129049963
2-[(9R)-9-[5-[(2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentyl]-6-oxaspiro[4.5]decan-9-yl]pyridine (PubChem CID 129049963) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 2-[(9R)-9-[5-[(2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentyl]-6-oxaspiro[4.5]decan-9-yl]pyridine.
| Compound Name | 2-[(9R)-9-[5-[(2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
|---|---|
| PubChem CID | 129049963 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 2-[(9R)-9-[5-[(2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]pentyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
| SMILES | CO[C@H]1Cc2ccccc2C1CCCCC[C@@]1(c2ccccn2)CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C29H39NO2/c1-31-26-21-23-11-4-5-12-24(23)25(26)13-3-2-7-15-28(27-14-6-10-19-30-27)18-20-32-29(22-28)16-8-9-17-29/h4-6,10-12,14,19,25-26H,2-3,7-9,13,15-18,20-22H2,1H3/t25?,26-,28+/m0/s1 |
| InChIKey | HUBKLPIITHMFQO-ZLEDJERYSA-N |
| XLogP | 6.75 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|